CAS 1391053-00-1 is the registry number for N-Demethyl Ricinine-13C3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
4-methoxy-2-oxo-(4,5,6-13C3)1H-pyridine-3-carbonitrile (CAS 1391053-00-1) is a chemical compound with the molecular formula C7H6N2O2 and a molecular weight of 153.11 g/mol. IUPAC name: 4-methoxy-2-oxo-(4,5,6-13C3)1H-pyridine-3-carbonitrile. InChIKey: MWGIDWPSRDMIQN-BGLDBIDLSA-N.
| Molecular formula | C7H6N2O2 |
|---|---|
| Molecular weight | 153.11 g/mol |
| IUPAC name | 4-methoxy-2-oxo-(4,5,6-13C3)1H-pyridine-3-carbonitrile |
| InChIKey | MWGIDWPSRDMIQN-BGLDBIDLSA-N |
| SMILES | CO[13C]1=C(C(=O)N[13CH]=[13CH]1)C#N |
Computed by PubChem (NCBI)