CAS 1391053-20-5 is the registry number for Tenofovir Isopropyl Carbamate. Offered by: TRC. Available pack sizes: 10mg, 1mg.
[(2R)-1-[6-(propan-2-yloxycarbonylamino)purin-9-yl]propan-2-yl]oxymethylphosphonic acid (CAS 1391053-20-5) is a chemical compound with the molecular formula C13H20N5O6P and a molecular weight of 373.30 g/mol. IUPAC name: [(2R)-1-[6-(propan-2-yloxycarbonylamino)purin-9-yl]propan-2-yl]oxymethylphosphonic acid. InChIKey: HKTHVGLNIJWELG-SECBINFHSA-N.
| Molecular formula | C13H20N5O6P |
|---|---|
| Molecular weight | 373.30 g/mol |
| IUPAC name | [(2R)-1-[6-(propan-2-yloxycarbonylamino)purin-9-yl]propan-2-yl]oxymethylphosphonic acid |
| InChIKey | HKTHVGLNIJWELG-SECBINFHSA-N |
| SMILES | C[C@H](CN1C=NC2=C(N=CN=C21)NC(=O)OC(C)C)OCP(=O)(O)O |
Computed by PubChem (NCBI)