Products 1391053-36-3
CAS 1391053-36-3 is the registry number for 4-Acetyloxy-N-despropyl N-tert-butyloxycarbonyl ropivacaine. Offered by: Biosynth. Available pack sizes: 250mg, 500mg.
Tert-butyl (2S)-2-[(4-acetyloxy-2,6-dimethylphenyl)carbamoyl]piperidine-1-carboxylate (CAS 1391053-36-3) is a chemical compound with the molecular formula C21H30N2O5 and a molecular weight of 390.5 g/mol. IUPAC name: tert-butyl (2S)-2-[(4-acetyloxy-2,6-dimethylphenyl)carbamoyl]piperidine-1-carboxylate. InChIKey: ANUDIDCCGVOCOU-KRWDZBQOSA-N.
| Molecular formula | C21H30N2O5 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(4-acetyloxy-2,6-dimethylphenyl)carbamoyl]piperidine-1-carboxylate |
| InChIKey | ANUDIDCCGVOCOU-KRWDZBQOSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=O)[C@@H]2CCCCN2C(=O)OC(C)(C)C)C)OC(=O)C |
Computed by PubChem (NCBI)