CAS 1391054-60-6 appears in our catalog under these names: Benz(a)anthracene-7-chloromethane-13C, Benz[a]anthracene-7-chloromethane-13C. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
7-(chloro(113C)methyl)benzo[a]anthracene (CAS 1391054-60-6) is a chemical compound with the molecular formula C19H13Cl and a molecular weight of 277.7 g/mol. IUPAC name: 7-(chloro(113C)methyl)benzo[a]anthracene. InChIKey: KUEKYPPUOKZVFM-HNHCFKFXSA-N.
| Molecular formula | C19H13Cl |
|---|---|
| Molecular weight | 277.7 g/mol |
| IUPAC name | 7-(chloro(113C)methyl)benzo[a]anthracene |
| InChIKey | KUEKYPPUOKZVFM-HNHCFKFXSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C(C4=CC=CC=C4C=C32)[13CH2]Cl |
Computed by PubChem (NCBI)