CAS 1391054-72-0 appears in our catalog under these names: Desmethylene Oxobexarotene-13C4 Methyl Ester, Desmethylene oxobexarotene methyl ester-13C4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
Methyl 4-[3-methyl-5,5,8,8-tetra((113C)methyl)-6,7-dihydronaphthalene-2-carbonyl]benzoate (CAS 1391054-72-0) is a chemical compound with the molecular formula C24H28O3 and a molecular weight of 368.4 g/mol. IUPAC name: methyl 4-[3-methyl-5,5,8,8-tetra((113C)methyl)-6,7-dihydronaphthalene-2-carbonyl]benzoate. InChIKey: DYVLPJYIGJZAKF-LBHFFFFPSA-N.
| Molecular formula | C24H28O3 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | methyl 4-[3-methyl-5,5,8,8-tetra((113C)methyl)-6,7-dihydronaphthalene-2-carbonyl]benzoate |
| InChIKey | DYVLPJYIGJZAKF-LBHFFFFPSA-N |
| SMILES | CC1=CC2=C(C=C1C(=O)C3=CC=C(C=C3)C(=O)OC)C(CCC2([13CH3])[13CH3])([13CH3])[13CH3] |
Computed by PubChem (NCBI)