CAS 1391054-78-6 is the registry number for N-Desmethyl Eletriptan Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 50mg, 100mg.
5-[2-(benzenesulfonyl)ethyl]-3-[[(2R)-pyrrolidin-2-yl]methyl]-1H-indole;hydrochloride (CAS 1391054-78-6) is a chemical compound with the molecular formula C21H25ClN2O2S and a molecular weight of 405.0 g/mol. IUPAC name: 5-[2-(benzenesulfonyl)ethyl]-3-[[(2R)-pyrrolidin-2-yl]methyl]-1H-indole;hydrochloride. InChIKey: PPISBGKXDNXXHO-GMUIIQOCSA-N.
| Molecular formula | C21H25ClN2O2S |
|---|---|
| Molecular weight | 405.0 g/mol |
| IUPAC name | 5-[2-(benzenesulfonyl)ethyl]-3-[[(2R)-pyrrolidin-2-yl]methyl]-1H-indole;hydrochloride |
| InChIKey | PPISBGKXDNXXHO-GMUIIQOCSA-N |
| SMILES | C1C[C@@H](NC1)CC2=CNC3=C2C=C(C=C3)CCS(=O)(=O)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)