Products 1391062-49-9

CAS 1391062-49-9 is the registry number for Sulfasalazine EP Impurity B. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-hydroxy-3,5-bis[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid (CAS 1391062-49-9) is a chemical compound with the molecular formula C29H22N8O7S2 and a molecular weight of 658.7 g/mol. IUPAC name: 2-hydroxy-3,5-bis[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid. InChIKey: XUCGEVUEJYLZHM-UHFFFAOYSA-N.

Identity
Molecular formulaC29H22N8O7S2
Molecular weight658.7 g/mol
IUPAC name2-hydroxy-3,5-bis[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid
InChIKeyXUCGEVUEJYLZHM-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N=NC3=CC(=C(C(=C3)N=NC4=CC=C(C=C4)S(=O)(=O)NC5=CC=CC=N5)O)C(=O)O

Computed by PubChem (NCBI)