CAS 1391062-49-9 is the registry number for Sulfasalazine EP Impurity B. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-3,5-bis[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid (CAS 1391062-49-9) is a chemical compound with the molecular formula C29H22N8O7S2 and a molecular weight of 658.7 g/mol. IUPAC name: 2-hydroxy-3,5-bis[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid. InChIKey: XUCGEVUEJYLZHM-UHFFFAOYSA-N.
| Molecular formula | C29H22N8O7S2 |
|---|---|
| Molecular weight | 658.7 g/mol |
| IUPAC name | 2-hydroxy-3,5-bis[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid |
| InChIKey | XUCGEVUEJYLZHM-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N=NC3=CC(=C(C(=C3)N=NC4=CC=C(C=C4)S(=O)(=O)NC5=CC=CC=N5)O)C(=O)O |
Computed by PubChem (NCBI)