CAS 1391068-16-8 appears in our catalog under these names: (2R)-2-Hydroxyglutaric Acid Octyl Ester Sodium Salt, >95% (HPLC), (2R)–Octyl–α–hydroxyglutarate sodium, (2R)-Octyl-α-hydroxyglutarate (sodium). Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 50mg, 5mg, 1 mg.
Sodium (4R)-4-hydroxy-5-octoxy-5-oxopentanoate (CAS 1391068-16-8) is a chemical compound with the molecular formula C13H23NaO5 and a molecular weight of 282.31 g/mol. IUPAC name: sodium (4R)-4-hydroxy-5-octoxy-5-oxopentanoate. InChIKey: UZUHAPHNUWGBFM-RFVHGSKJSA-M.
| Molecular formula | C13H23NaO5 |
|---|---|
| Molecular weight | 282.31 g/mol |
| IUPAC name | sodium (4R)-4-hydroxy-5-octoxy-5-oxopentanoate |
| InChIKey | UZUHAPHNUWGBFM-RFVHGSKJSA-M |
| SMILES | CCCCCCCCOC(=O)[C@@H](CCC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)