Products 1391119-36-0
CAS 1391119-36-0 is the registry number for 6-bromo-2-(trifluoromethyl)-2,3-dihydro-1H-indole, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
6-bromo-2-(trifluoromethyl)-2,3-dihydro-1H-indole (CAS 1391119-36-0) is a chemical compound with the molecular formula C9H7BrF3N and a molecular weight of 266.06 g/mol. IUPAC name: 6-bromo-2-(trifluoromethyl)-2,3-dihydro-1H-indole. InChIKey: OOWKRVRVCZKHAE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3N |
|---|---|
| Molecular weight | 266.06 g/mol |
| IUPAC name | 6-bromo-2-(trifluoromethyl)-2,3-dihydro-1H-indole |
| InChIKey | OOWKRVRVCZKHAE-UHFFFAOYSA-N |
| SMILES | C1C(NC2=C1C=CC(=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)