CAS 1391226-48-4 appears in our catalog under these names: 5-Bromo-2-(trifluoromethyl)-2,3-dihydro-1H-indole, 95%, 5-Bromo-2-(trifluoromethyl)-2,3-dihydro-1H-indole. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
5-bromo-2-(trifluoromethyl)-2,3-dihydro-1H-indole (CAS 1391226-48-4) is a chemical compound with the molecular formula C9H7BrF3N and a molecular weight of 266.06 g/mol. IUPAC name: 5-bromo-2-(trifluoromethyl)-2,3-dihydro-1H-indole. InChIKey: AWZWUAILGSGIFI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3N |
|---|---|
| Molecular weight | 266.06 g/mol |
| IUPAC name | 5-bromo-2-(trifluoromethyl)-2,3-dihydro-1H-indole |
| InChIKey | AWZWUAILGSGIFI-UHFFFAOYSA-N |
| SMILES | C1C(NC2=C1C=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)