Products 139115-59-6
CAS 139115-59-6 is the registry number for Isomurralonginol acetate. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
[2-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-3-enyl] acetate (CAS 139115-59-6) is a chemical compound with the molecular formula C17H18O5 and a molecular weight of 302.32 g/mol. IUPAC name: [2-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-3-enyl] acetate. InChIKey: KJRYZFDEVYMOEY-UHFFFAOYSA-N.
| Molecular formula | C17H18O5 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | [2-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-3-enyl] acetate |
| InChIKey | KJRYZFDEVYMOEY-UHFFFAOYSA-N |
| SMILES | CC(=C)C(COC(=O)C)C1=C(C=CC2=C1OC(=O)C=C2)OC |
Computed by PubChem (NCBI)