CAS 139139-81-4 appears in our catalog under these names: Bis(4–bromophenyl)iodonium triflate, Bis(4-bromophenyl)iodonium triflate, Bis(4-bromophenyl)iodonium trifluoromethanesulfonate 97%, Bis(4-bromophenyl)iodonium triflate, 96%, Bis(4-bromophenyl)iodonium Trifluoromethanesulfonate, 96%, 96%. Offered by: GLPBio, Chemat, Sigma-Aldrich, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg.
Bis(4-bromophenyl)iodanium;trifluoromethanesulfonate (CAS 139139-81-4) is a chemical compound with the molecular formula C13H8Br2F3IO3S and a molecular weight of 587.97 g/mol. IUPAC name: bis(4-bromophenyl)iodanium;trifluoromethanesulfonate. InChIKey: HJAMWVFQXYTJBE-UHFFFAOYSA-M.
| Molecular formula | C13H8Br2F3IO3S |
|---|---|
| Molecular weight | 587.97 g/mol |
| IUPAC name | bis(4-bromophenyl)iodanium;trifluoromethanesulfonate |
| InChIKey | HJAMWVFQXYTJBE-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1Br)[I+]C2=CC=C(C=C2)Br.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)