CAS 1391393-86-4 is the registry number for 3-O-Methyl-L-DOPA 4-Sulfate. Offered by: TRC. Available pack sizes: 100mg.
(2S)-2-amino-3-(3-methoxy-4-sulfooxyphenyl)propanoic acid (CAS 1391393-86-4) is a chemical compound with the molecular formula C10H13NO7S and a molecular weight of 291.28 g/mol. IUPAC name: (2S)-2-amino-3-(3-methoxy-4-sulfooxyphenyl)propanoic acid. InChIKey: OOMSDJKDKVRCSI-ZETCQYMHSA-N.
| Molecular formula | C10H13NO7S |
|---|---|
| Molecular weight | 291.28 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-methoxy-4-sulfooxyphenyl)propanoic acid |
| InChIKey | OOMSDJKDKVRCSI-ZETCQYMHSA-N |
| SMILES | COC1=C(C=CC(=C1)C[C@@H](C(=O)O)N)OS(=O)(=O)O |
Computed by PubChem (NCBI)