CAS 1391394-05-0 is the registry number for (S)-1-(5-Bromo-3-fluoropyridin-2-yl)ethan-1-amine dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1S)-1-(5-bromo-3-fluoro-2-pyridinyl)ethanamine;dihydrochloride (CAS 1391394-05-0) is a chemical compound with the molecular formula C7H10BrCl2FN2 and a molecular weight of 291.97 g/mol. IUPAC name: (1S)-1-(5-bromo-3-fluoro-2-pyridinyl)ethanamine;dihydrochloride. InChIKey: FNJJBBZHKWTJNE-FHNDMYTFSA-N.
| Molecular formula | C7H10BrCl2FN2 |
|---|---|
| Molecular weight | 291.97 g/mol |
| IUPAC name | (1S)-1-(5-bromo-3-fluoro-2-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | FNJJBBZHKWTJNE-FHNDMYTFSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=N1)Br)F)N.Cl.Cl |
Computed by PubChem (NCBI)