CAS 1391444-87-3 appears in our catalog under these names: (R)-1-(6-Chloropyridin-3-yl)ethan-1-amine hydrochloride, (R)-1-(6-Chloropyridin-3-yl)ethan-1-amine hydrochloride, 97%, 97%, (R)-1-(6-Chloropyridin-3-yl)ethan-1-amine hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(1R)-1-(6-chloro-3-pyridinyl)ethanamine;hydrochloride (CAS 1391444-87-3) is a chemical compound with the molecular formula C7H10Cl2N2 and a molecular weight of 193.07 g/mol. IUPAC name: (1R)-1-(6-chloro-3-pyridinyl)ethanamine;hydrochloride. InChIKey: FFDARTLRQCBNRB-NUBCRITNSA-N.
| Molecular formula | C7H10Cl2N2 |
|---|---|
| Molecular weight | 193.07 g/mol |
| IUPAC name | (1R)-1-(6-chloro-3-pyridinyl)ethanamine;hydrochloride |
| InChIKey | FFDARTLRQCBNRB-NUBCRITNSA-N |
| SMILES | C[C@H](C1=CN=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)