CAS 1391486-12-6 appears in our catalog under these names: CI 2201, Cl2201. Offered by: TRC, GLPBio. Available pack sizes: 250mg, 1mg, 10mg, 25mg, 5mg.
(4-chloronaphthalen-1-yl)-[1-(5-fluoropentyl)indol-3-yl]methanone (CAS 1391486-12-6) is a chemical compound with the molecular formula C24H21ClFNO and a molecular weight of 393.9 g/mol. IUPAC name: (4-chloronaphthalen-1-yl)-[1-(5-fluoropentyl)indol-3-yl]methanone. InChIKey: MJSLVWWUOKKZTQ-UHFFFAOYSA-N.
| Molecular formula | C24H21ClFNO |
|---|---|
| Molecular weight | 393.9 g/mol |
| IUPAC name | (4-chloronaphthalen-1-yl)-[1-(5-fluoropentyl)indol-3-yl]methanone |
| InChIKey | MJSLVWWUOKKZTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Cl)C(=O)C3=CN(C4=CC=CC=C43)CCCCCF |
Computed by PubChem (NCBI)