CAS 1391508-43-2 appears in our catalog under these names: Fmoc-Tyr(3,5-Cl2)-OH, 95%, 95%, Fmoc-L-Tyr(3,5-Cl2)-OH, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100mg, 250mg, 1g, 5g.
(2S)-3-(3,5-dichloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1391508-43-2) is a chemical compound with the molecular formula C24H19Cl2NO5 and a molecular weight of 472.3 g/mol. IUPAC name: (2S)-3-(3,5-dichloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: MWKLAKPPKIOFFC-NRFANRHFSA-N.
| Molecular formula | C24H19Cl2NO5 |
|---|---|
| Molecular weight | 472.3 g/mol |
| IUPAC name | (2S)-3-(3,5-dichloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | MWKLAKPPKIOFFC-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=C(C(=C4)Cl)O)Cl)C(=O)O |
Computed by PubChem (NCBI)