CAS 1391525-88-4 appears in our catalog under these names: (R)-1-(4-Bromophenyl)-2-methylpropan-1-amine hydrochloride, 95%, (R)–1–(4–Bromophenyl)–2–methylpropan–1–amine hydrochloride, Benzenemethanamine, 4-bromo-α-(1-methylethyl)-, hydrochloride (1:1), (αR)-, 95%+, 95%+, (R)-1-(4-bromophenyl)-2-methylpropan-1-amine hydrochloride, 95%+. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg.
(1R)-1-(4-bromophenyl)-2-methylpropan-1-amine;hydrochloride (CAS 1391525-88-4) is a chemical compound with the molecular formula C10H15BrClN and a molecular weight of 264.59 g/mol. IUPAC name: (1R)-1-(4-bromophenyl)-2-methylpropan-1-amine;hydrochloride. InChIKey: LEQDIWNGVYSISP-HNCPQSOCSA-N.
| Molecular formula | C10H15BrClN |
|---|---|
| Molecular weight | 264.59 g/mol |
| IUPAC name | (1R)-1-(4-bromophenyl)-2-methylpropan-1-amine;hydrochloride |
| InChIKey | LEQDIWNGVYSISP-HNCPQSOCSA-N |
| SMILES | CC(C)[C@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)