CAS 1391545-11-1 is the registry number for (1S,2S)-1,2-Bis(3,5-dimethylphenyl)-1,2-ethylenediamine phosphate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
(1S,2S)-1,2-bis(3,5-dimethylphenyl)ethane-1,2-diamine;phosphoric acid (CAS 1391545-11-1) is a chemical compound with the molecular formula C18H27N2O4P and a molecular weight of 366.4 g/mol. IUPAC name: (1S,2S)-1,2-bis(3,5-dimethylphenyl)ethane-1,2-diamine;phosphoric acid. InChIKey: ZKDGAFBRVLBNCX-APTPAJQOSA-N.
| Molecular formula | C18H27N2O4P |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (1S,2S)-1,2-bis(3,5-dimethylphenyl)ethane-1,2-diamine;phosphoric acid |
| InChIKey | ZKDGAFBRVLBNCX-APTPAJQOSA-N |
| SMILES | CC1=CC(=CC(=C1)[C@@H]([C@H](C2=CC(=CC(=C2)C)C)N)N)C.OP(=O)(O)O |
Computed by PubChem (NCBI)