CAS 1391551-89-5 appears in our catalog under these names: L-2-(O-Bromo-p-fluorophenyl)glycine hydrochloride, 95%, (S)–2–amino–2–(2–bromo–4–fluorophenyl)acetic acid hcl, (S)-2-amino-2-(2-bromo-4-fluorophenyl)acetic acid hcl, 98%, 98%, (S)-2-Amino-2-(2-bromo-4-fluorophenyl)acetic acid hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(2S)-2-amino-2-(2-bromo-4-fluorophenyl)acetic acid;hydrochloride (CAS 1391551-89-5) is a chemical compound with the molecular formula C8H8BrClFNO2 and a molecular weight of 284.51 g/mol. IUPAC name: (2S)-2-amino-2-(2-bromo-4-fluorophenyl)acetic acid;hydrochloride. InChIKey: HDBZXNOVHSWDPF-FJXQXJEOSA-N.
| Molecular formula | C8H8BrClFNO2 |
|---|---|
| Molecular weight | 284.51 g/mol |
| IUPAC name | (2S)-2-amino-2-(2-bromo-4-fluorophenyl)acetic acid;hydrochloride |
| InChIKey | HDBZXNOVHSWDPF-FJXQXJEOSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)