CAS 1391584-88-5 is the registry number for N-((1S,2S)-2-Amino-1,2-diphenylethyl)-2,4-dimethoxybenzenesulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,4-dimethoxybenzenesulfonamide (CAS 1391584-88-5) is a chemical compound with the molecular formula C22H24N2O4S and a molecular weight of 412.5 g/mol. IUPAC name: N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,4-dimethoxybenzenesulfonamide. InChIKey: DJVGCYOUWVNJIL-VXKWHMMOSA-N.
| Molecular formula | C22H24N2O4S |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,4-dimethoxybenzenesulfonamide |
| InChIKey | DJVGCYOUWVNJIL-VXKWHMMOSA-N |
| SMILES | COC1=CC(=C(C=C1)S(=O)(=O)N[C@@H](C2=CC=CC=C2)[C@H](C3=CC=CC=C3)N)OC |
Computed by PubChem (NCBI)