CAS 1391594-37-8 is the registry number for Ticagrelor Impurity 155. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Trans-(1R,2S)-2-(2-fluorophenyl)cyclopropan-1-amine (CAS 1391594-37-8) is a chemical compound with the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. IUPAC name: trans-(1R,2S)-2-(2-fluorophenyl)cyclopropan-1-amine. InChIKey: ZIOFMQVJOFSLSH-IONNQARKSA-N.
| Molecular formula | C9H10FN |
|---|---|
| Molecular weight | 151.18 g/mol |
| IUPAC name | trans-(1R,2S)-2-(2-fluorophenyl)cyclopropan-1-amine |
| InChIKey | ZIOFMQVJOFSLSH-IONNQARKSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=CC=C2F |
Computed by PubChem (NCBI)