Products 1391594-37-8

CAS 1391594-37-8 is the registry number for Ticagrelor Impurity 155. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Trans-(1R,2S)-2-(2-fluorophenyl)cyclopropan-1-amine (CAS 1391594-37-8) is a chemical compound with the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. IUPAC name: trans-(1R,2S)-2-(2-fluorophenyl)cyclopropan-1-amine. InChIKey: ZIOFMQVJOFSLSH-IONNQARKSA-N.

Identity
Molecular formulaC9H10FN
Molecular weight151.18 g/mol
IUPAC nametrans-(1R,2S)-2-(2-fluorophenyl)cyclopropan-1-amine
InChIKeyZIOFMQVJOFSLSH-IONNQARKSA-N
SMILESC1[C@H]([C@@H]1N)C2=CC=CC=C2F

Computed by PubChem (NCBI)