Products 1391630-04-8
CAS 1391630-04-8 is the registry number for (3S，6R)–6–(tert–Butoxymethyl)–3–isobutylpiperazin–2–one. Offered by: GLPBio. Available pack sizes: 1g.
(3S,6R)-6-[(2-methylpropan-2-yl)oxymethyl]-3-(2-methylpropyl)piperazin-2-one (CAS 1391630-04-8) is a chemical compound with the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. IUPAC name: (3S,6R)-6-[(2-methylpropan-2-yl)oxymethyl]-3-(2-methylpropyl)piperazin-2-one. InChIKey: NTELQFLENMDUOG-MNOVXSKESA-N.
| Molecular formula | C13H26N2O2 |
|---|---|
| Molecular weight | 242.36 g/mol |
| IUPAC name | (3S,6R)-6-[(2-methylpropan-2-yl)oxymethyl]-3-(2-methylpropyl)piperazin-2-one |
| InChIKey | NTELQFLENMDUOG-MNOVXSKESA-N |
| SMILES | CC(C)C[C@H]1C(=O)N[C@H](CN1)COC(C)(C)C |
Computed by PubChem (NCBI)