CAS 139165-54-1 is the registry number for 1,4-Dichlorobutane-2S-3S-diol. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
(2S,3S)-1,4-dichlorobutane-2,3-diol (CAS 139165-54-1) is a chemical compound with the molecular formula C4H8Cl2O2 and a molecular weight of 159.01 g/mol. IUPAC name: (2S,3S)-1,4-dichlorobutane-2,3-diol. InChIKey: SAUBRJOIKMVSRU-QWWZWVQMSA-N.
| Molecular formula | C4H8Cl2O2 |
|---|---|
| Molecular weight | 159.01 g/mol |
| IUPAC name | (2S,3S)-1,4-dichlorobutane-2,3-diol |
| InChIKey | SAUBRJOIKMVSRU-QWWZWVQMSA-N |
| SMILES | C([C@H]([C@@H](CCl)O)O)Cl |
Computed by PubChem (NCBI)