CAS 1391731-16-0 appears in our catalog under these names: N-Boc-(1s, 2r)-diaminocyclohexane (r)-hydroxyphenylacetic acid salt, 95%, Tert–Butyl ((1S,2R)–2–aminocyclohexyl)carbamate (R)–2–hydroxy–2–phenylacetate, Tert-Butyl ((1S,2R)-2-aminocyclohexyl)carbamate (R)-2-hydroxy-2-phenylacetate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
Tert-butyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;(2R)-2-hydroxy-2-phenylacetic acid (CAS 1391731-16-0) is a chemical compound with the molecular formula C19H30N2O5 and a molecular weight of 366.5 g/mol. IUPAC name: tert-butyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;(2R)-2-hydroxy-2-phenylacetic acid. InChIKey: HAQTXHODPIHEOH-YOTSKVBOSA-N.
| Molecular formula | C19H30N2O5 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;(2R)-2-hydroxy-2-phenylacetic acid |
| InChIKey | HAQTXHODPIHEOH-YOTSKVBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC[C@H]1N.C1=CC=C(C=C1)[C@H](C(=O)O)O |
Computed by PubChem (NCBI)