CAS 139181-27-4 is the registry number for 2-(Furan-2-yl)-5-(methylthio)-(1,2,4)triazolo(1,5-a)(1,3,5)triazin-7-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-(furan-2-yl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (CAS 139181-27-4) is a chemical compound with the molecular formula C9H8N6OS and a molecular weight of 248.27 g/mol. IUPAC name: 2-(furan-2-yl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine. InChIKey: APSHQFCMMKRIFB-UHFFFAOYSA-N.
| Molecular formula | C9H8N6OS |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 2-(furan-2-yl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| InChIKey | APSHQFCMMKRIFB-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=NC(=NN2C(=N1)N)C3=CC=CO3 |
Computed by PubChem (NCBI)