CAS 139181-42-3 appears in our catalog under these names: 4-(2-Aminoethyl)phenyl pivalate 2,2,2-trifluoroacetate, 95%, 4–(2–Aminoethyl)Phenyl Pivalate 2,2,2–Trifluoroacetate, 4-(2-Aminoethyl)phenyl pivalate 2,2,2-trifluoroacetate, 98%, 98%, 4-(2-AMINOETHYL)PHENYL PIVALATE 2,2,2-TRIFLUOROACETATE, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
[4-(2-aminoethyl)phenyl] 2,2-dimethylpropanoate;2,2,2-trifluoroacetic acid (CAS 139181-42-3) is a chemical compound with the molecular formula C15H20F3NO4 and a molecular weight of 335.32 g/mol. IUPAC name: [4-(2-aminoethyl)phenyl] 2,2-dimethylpropanoate;2,2,2-trifluoroacetic acid. InChIKey: USJJHVHYUMVDIS-UHFFFAOYSA-N.
| Molecular formula | C15H20F3NO4 |
|---|---|
| Molecular weight | 335.32 g/mol |
| IUPAC name | [4-(2-aminoethyl)phenyl] 2,2-dimethylpropanoate;2,2,2-trifluoroacetic acid |
| InChIKey | USJJHVHYUMVDIS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC=C(C=C1)CCN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)