CAS 139189-30-3 is the registry number for Tetrakis(2,6-dimethylphenyl) 1,3-phenylenebisphosphate. Offered by: TRC. Available pack sizes: 500mg.
[3-bis(2,6-dimethylphenoxy)phosphoryloxyphenyl] bis(2,6-dimethylphenyl) phosphate (CAS 139189-30-3) is a chemical compound with the molecular formula C38H40O8P2 and a molecular weight of 686.7 g/mol. IUPAC name: [3-bis(2,6-dimethylphenoxy)phosphoryloxyphenyl] bis(2,6-dimethylphenyl) phosphate. InChIKey: YOLFSLXHLNWPKG-UHFFFAOYSA-N.
| Molecular formula | C38H40O8P2 |
|---|---|
| Molecular weight | 686.7 g/mol |
| IUPAC name | [3-bis(2,6-dimethylphenoxy)phosphoryloxyphenyl] bis(2,6-dimethylphenyl) phosphate |
| InChIKey | YOLFSLXHLNWPKG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OP(=O)(OC2=CC(=CC=C2)OP(=O)(OC3=C(C=CC=C3C)C)OC4=C(C=CC=C4C)C)OC5=C(C=CC=C5C)C |
Computed by PubChem (NCBI)