CAS 1392129-96-2 appears in our catalog under these names: Sulfaclozine sodium monohydrate, Sulfachloropyrazine Sodium Monohydrate, >95% (HPLC). Offered by: Dr. Ehrenstorfer, TRC, Biosynth. Available pack sizes: 100mg, 1g, 50mg, 250mg, 500mg, 1000mg.
Sodium;(4-aminophenyl)sulfonyl-(6-chloropyrazin-2-yl)azanide;hydrate (CAS 1392129-96-2) is a chemical compound with the molecular formula C10H10ClN4NaO3S and a molecular weight of 324.72 g/mol. IUPAC name: sodium;(4-aminophenyl)sulfonyl-(6-chloropyrazin-2-yl)azanide;hydrate. InChIKey: PCDSLLFCMAPONC-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN4NaO3S |
|---|---|
| Molecular weight | 324.72 g/mol |
| IUPAC name | sodium;(4-aminophenyl)sulfonyl-(6-chloropyrazin-2-yl)azanide;hydrate |
| InChIKey | PCDSLLFCMAPONC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)[N-]C2=CN=CC(=N2)Cl.O.[Na+] |
Computed by PubChem (NCBI)