Products 1392146-23-4
CAS 1392146-23-4 is the registry number for 2,6-Di-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,6-ditert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1392146-23-4) is a chemical compound with the molecular formula C19H32BNO2 and a molecular weight of 317.3 g/mol. IUPAC name: 2,6-ditert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: YXMIJQKROKOULP-UHFFFAOYSA-N.
| Molecular formula | C19H32BNO2 |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | YXMIJQKROKOULP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)