CAS 1392208-11-5 appears in our catalog under these names: Phenylbutyrate-d11 Sodium Salt, Sodium 4–Phenylbutyrate–d11, Phenylbutyrate-d11 (sodium), 99.85%. Offered by: Chemat Brand, Hubei YoungXin, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 500μg.
Sodium 2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoate (CAS 1392208-11-5) is a chemical compound with the molecular formula C10H11NaO2 and a molecular weight of 197.25 g/mol. IUPAC name: sodium 2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoate. InChIKey: VPZRWNZGLKXFOE-HSYGEVHBSA-M.
| Molecular formula | C10H11NaO2 |
|---|---|
| Molecular weight | 197.25 g/mol |
| IUPAC name | sodium 2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoate |
| InChIKey | VPZRWNZGLKXFOE-HSYGEVHBSA-M |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-])[2H])[2H].[Na+] |
Computed by PubChem (NCBI)