CAS 1392512-51-4 is the registry number for 7,9-Diphenyl-7H-acenaphtho[1,2-d]imidazol-9-ium chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7,9-diphenylacenaphthyleno[1,2-d]imidazol-9-ium chloride (CAS 1392512-51-4) is a chemical compound with the molecular formula C25H17ClN2 and a molecular weight of 380.9 g/mol. IUPAC name: 7,9-diphenylacenaphthyleno[1,2-d]imidazol-9-ium chloride. InChIKey: SQOSMVJPHRIHRW-UHFFFAOYSA-M.
| Molecular formula | C25H17ClN2 |
|---|---|
| Molecular weight | 380.9 g/mol |
| IUPAC name | 7,9-diphenylacenaphthyleno[1,2-d]imidazol-9-ium chloride |
| InChIKey | SQOSMVJPHRIHRW-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)N2C=[N+](C3=C2C4=CC=CC5=C4C3=CC=C5)C6=CC=CC=C6.[Cl-] |
Computed by PubChem (NCBI)