CAS 13927-71-4 appears in our catalog under these names: Copper(ii) dibutyldithiocarbamate, 98%, Copper(II) Dibutyldithiocarbamate, Copper(II) Dibutyldithiocarbamate, >98.0%(T), Copper(II) dibutyldithiocarbamate, Copper(II) dibutylcarbamodithioate 98%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 500g, 250g, 1kg.
Copper bis(N,N-dibutylcarbamodithioate) (CAS 13927-71-4) is a chemical compound with the molecular formula C18H36CuN2S4 and a molecular weight of 472.3 g/mol. IUPAC name: copper bis(N,N-dibutylcarbamodithioate). InChIKey: IXPUJMULXNNEHS-UHFFFAOYSA-L.
| Molecular formula | C18H36CuN2S4 |
|---|---|
| Molecular weight | 472.3 g/mol |
| IUPAC name | copper bis(N,N-dibutylcarbamodithioate) |
| InChIKey | IXPUJMULXNNEHS-UHFFFAOYSA-L |
| SMILES | CCCCN(CCCC)C(=S)[S-].CCCCN(CCCC)C(=S)[S-].[Cu+2] |
Computed by PubChem (NCBI)