CAS 1392809-08-3 appears in our catalog under these names: MRL-871, >95% (HPLC), MRL–871, MRL-871, MRL-871 98%, 4-(1-(2-Chloro-6-(trifluoromethyl)benzoyl)-1H-indazol-3-yl)benzoic acid. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2,5mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
4-[1-[2-chloro-6-(trifluoromethyl)benzoyl]indazol-3-yl]benzoic acid (CAS 1392809-08-3) is a chemical compound with the molecular formula C22H12ClF3N2O3 and a molecular weight of 444.8 g/mol. IUPAC name: 4-[1-[2-chloro-6-(trifluoromethyl)benzoyl]indazol-3-yl]benzoic acid. InChIKey: DANLZOIRUUHIIX-UHFFFAOYSA-N.
| Molecular formula | C22H12ClF3N2O3 |
|---|---|
| Molecular weight | 444.8 g/mol |
| IUPAC name | 4-[1-[2-chloro-6-(trifluoromethyl)benzoyl]indazol-3-yl]benzoic acid |
| InChIKey | DANLZOIRUUHIIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2C(=O)C3=C(C=CC=C3Cl)C(F)(F)F)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)