CAS 1393112-44-1 is the registry number for Lapatinib Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
5-[4-[3-chloro-4-[(2-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-carbaldehyde (CAS 1393112-44-1) is a chemical compound with the molecular formula C26H17ClFN3O3 and a molecular weight of 473.9 g/mol. IUPAC name: 5-[4-[3-chloro-4-[(2-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-carbaldehyde. InChIKey: GDGMJBPERREXMC-UHFFFAOYSA-N.
| Molecular formula | C26H17ClFN3O3 |
|---|---|
| Molecular weight | 473.9 g/mol |
| IUPAC name | 5-[4-[3-chloro-4-[(2-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-carbaldehyde |
| InChIKey | GDGMJBPERREXMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=C(C=C(C=C2)NC3=NC=NC4=C3C=C(C=C4)C5=CC=C(O5)C=O)Cl)F |
Computed by PubChem (NCBI)