CAS 139332-64-2 appears in our catalog under these names: Dbd-pz, 98%, DBD-PZ [=4-(N,N-Dimethylaminosulfonyl)-7-piperazino-2,1,3-benzoxadiazole] [for HPLC Labeling], >98.0%(HPLC), DBD-PZ, N,N-dimethyl-7-(piperazin-1-yl)benzo[c][1,2,5]oxadiazole-4-sulfonamide, >=98%(HPLC). Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 10mg.
N,N-dimethyl-7-piperazin-1-yl-2,1,3-benzoxadiazole-4-sulfonamide (CAS 139332-64-2) is a chemical compound with the molecular formula C12H17N5O3S and a molecular weight of 311.36 g/mol. IUPAC name: N,N-dimethyl-7-piperazin-1-yl-2,1,3-benzoxadiazole-4-sulfonamide. InChIKey: XFQLOSBBYVMBGT-UHFFFAOYSA-N.
| Molecular formula | C12H17N5O3S |
|---|---|
| Molecular weight | 311.36 g/mol |
| IUPAC name | N,N-dimethyl-7-piperazin-1-yl-2,1,3-benzoxadiazole-4-sulfonamide |
| InChIKey | XFQLOSBBYVMBGT-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C2=NON=C12)N3CCNCC3 |
Computed by PubChem (NCBI)