CAS 1393330-64-7 is the registry number for 6-Bromo-3-(3-fluorophenyl)-(1,2,4)triazolo(4,3-a)pyridine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine (CAS 1393330-64-7) is a chemical compound with the molecular formula C12H7BrFN3 and a molecular weight of 292.11 g/mol. IUPAC name: 6-bromo-3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: AMGPITBXDJQDJO-UHFFFAOYSA-N.
| Molecular formula | C12H7BrFN3 |
|---|---|
| Molecular weight | 292.11 g/mol |
| IUPAC name | 6-bromo-3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | AMGPITBXDJQDJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NN=C3N2C=C(C=C3)Br |
Computed by PubChem (NCBI)