CAS 1393330-68-1 is the registry number for 5-(Piperidin-3-yl)-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-piperidin-3-yl-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole;hydrochloride (CAS 1393330-68-1) is a chemical compound with the molecular formula C9H13ClF3N3O and a molecular weight of 271.67 g/mol. IUPAC name: 5-piperidin-3-yl-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole;hydrochloride. InChIKey: UGELRRRYPHQVIM-UHFFFAOYSA-N.
| Molecular formula | C9H13ClF3N3O |
|---|---|
| Molecular weight | 271.67 g/mol |
| IUPAC name | 5-piperidin-3-yl-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole;hydrochloride |
| InChIKey | UGELRRRYPHQVIM-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=NC(=NO2)CC(F)(F)F.Cl |
Computed by PubChem (NCBI)