CAS 139338-72-0 appears in our catalog under these names: Fmoc-NH-PEG3-CH2COOH, 95%, Fmoc–amino–PEG3–CH2COOH, Fmoc-mini-PEG-3 Fmoc-11-Amino-3,6,9-Trioxaundecanoic Acid (Syrup), Fmoc-amino-PEG3-CH2COOH 95%, 5,8,11-Trioxa-2-azatridecanedioic acid, 1-(9H-fluoren-9-ylmethyl) ester, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg, 50g, 100g.
2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]acetic acid (CAS 139338-72-0) is a chemical compound with the molecular formula C23H27NO7 and a molecular weight of 429.5 g/mol. IUPAC name: 2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: XNOJSAOJCBOZTA-UHFFFAOYSA-N.
| Molecular formula | C23H27NO7 |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | 2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | XNOJSAOJCBOZTA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)