CAS 1393441-98-9 is the registry number for N-(5-Aminosulfonylthiophen-2-yl)succinimide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-[(2,5-dioxopyrrolidin-1-yl)methyl]thiophene-2-sulfonamide (CAS 1393441-98-9) is a chemical compound with the molecular formula C9H10N2O4S2 and a molecular weight of 274.3 g/mol. IUPAC name: 5-[(2,5-dioxopyrrolidin-1-yl)methyl]thiophene-2-sulfonamide. InChIKey: ZZTHOMVMPIRNLH-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4S2 |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | 5-[(2,5-dioxopyrrolidin-1-yl)methyl]thiophene-2-sulfonamide |
| InChIKey | ZZTHOMVMPIRNLH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)CC2=CC=C(S2)S(=O)(=O)N |
Computed by PubChem (NCBI)