CAS 1393442-38-0 is the registry number for 3-(4-Iodopyrazol-1-yl)piperidine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-iodopyrazol-1-yl)piperidine;hydrochloride (CAS 1393442-38-0) is a chemical compound with the molecular formula C8H13ClIN3 and a molecular weight of 313.57 g/mol. IUPAC name: 3-(4-iodopyrazol-1-yl)piperidine;hydrochloride. InChIKey: YEPMTOGKIVQIKO-UHFFFAOYSA-N.
| Molecular formula | C8H13ClIN3 |
|---|---|
| Molecular weight | 313.57 g/mol |
| IUPAC name | 3-(4-iodopyrazol-1-yl)piperidine;hydrochloride |
| InChIKey | YEPMTOGKIVQIKO-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)N2C=C(C=N2)I.Cl |
Computed by PubChem (NCBI)