Products 1393583-66-8
CAS 1393583-66-8 is the registry number for 3-Fluoro-1,7-naphthyridin-8(7H)-one, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 50mg.
3-fluoro-7H-1,7-naphthyridin-8-one (CAS 1393583-66-8) is a chemical compound with the molecular formula C8H5FN2O and a molecular weight of 164.14 g/mol. IUPAC name: 3-fluoro-7H-1,7-naphthyridin-8-one. InChIKey: GBGBMKNQBLEZIW-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O |
|---|---|
| Molecular weight | 164.14 g/mol |
| IUPAC name | 3-fluoro-7H-1,7-naphthyridin-8-one |
| InChIKey | GBGBMKNQBLEZIW-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=NC=C(C=C21)F |
Computed by PubChem (NCBI)