CAS 1393584-90-1 appears in our catalog under these names: tert-Butyl-4-oxo-5-(trifluoromethyl)azepane-1-carboxylate, tert-Butyl 4-oxo-5-(trifluoromethyl)azepane-1-carboxylate. Offered by: TRC, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 4-oxo-5-(trifluoromethyl)azepane-1-carboxylate (CAS 1393584-90-1) is a chemical compound with the molecular formula C12H18F3NO3 and a molecular weight of 281.27 g/mol. IUPAC name: tert-butyl 4-oxo-5-(trifluoromethyl)azepane-1-carboxylate. InChIKey: NHPOEZNXKKOGCN-UHFFFAOYSA-N.
| Molecular formula | C12H18F3NO3 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | tert-butyl 4-oxo-5-(trifluoromethyl)azepane-1-carboxylate |
| InChIKey | NHPOEZNXKKOGCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)CC1)C(F)(F)F |
Computed by PubChem (NCBI)