CAS 1393813-43-8 appears in our catalog under these names: Macitentan Impurity 7, Macitentan Impurity 21, O-Desbromo-pyrimidinyl Macitentan, >95% (HPLC), N-(5-(4-Bromophenyl)-6-(2-hydroxyethoxy)-4-pyrimidinyl)-N′-propylsulfamide, N-(5-(4-Bromophenyl)-6-(2-hydroxyethoxy)pyrimidin-4-yl)propane-1-sulfamide 98%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 1g, 5g, 10g, 25g.
2-[5-(4-bromophenyl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol (CAS 1393813-43-8) is a chemical compound with the molecular formula C15H19BrN4O4S and a molecular weight of 431.3 g/mol. IUPAC name: 2-[5-(4-bromophenyl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol. InChIKey: MKPBJHFHEQSWAH-UHFFFAOYSA-N.
| Molecular formula | C15H19BrN4O4S |
|---|---|
| Molecular weight | 431.3 g/mol |
| IUPAC name | 2-[5-(4-bromophenyl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol |
| InChIKey | MKPBJHFHEQSWAH-UHFFFAOYSA-N |
| SMILES | CCCNS(=O)(=O)NC1=C(C(=NC=N1)OCCO)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)