CAS 13939-70-3 is the registry number for Phylloporphyrin, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(8,13-diethyl-3,7,12,17,20-pentamethyl-22,23-dihydroporphyrin-2-yl)propanoic acid (CAS 13939-70-3) is a chemical compound with the molecular formula C32H36N4O2 and a molecular weight of 508.7 g/mol. IUPAC name: 3-(8,13-diethyl-3,7,12,17,20-pentamethyl-22,23-dihydroporphyrin-2-yl)propanoic acid. InChIKey: CZDYTYJSBCQSRP-UHFFFAOYSA-N.
| Molecular formula | C32H36N4O2 |
|---|---|
| Molecular weight | 508.7 g/mol |
| IUPAC name | 3-(8,13-diethyl-3,7,12,17,20-pentamethyl-22,23-dihydroporphyrin-2-yl)propanoic acid |
| InChIKey | CZDYTYJSBCQSRP-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=CC3=C(C(=C(N3)C=C4C(=C(C(=N4)C(=C5C=C(C(=N5)C=C1N2)C)C)CCC(=O)O)C)C)CC)C |
Computed by PubChem (NCBI)