Products 13939-70-3

CAS 13939-70-3 is the registry number for Phylloporphyrin, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(8,13-diethyl-3,7,12,17,20-pentamethyl-22,23-dihydroporphyrin-2-yl)propanoic acid (CAS 13939-70-3) is a chemical compound with the molecular formula C32H36N4O2 and a molecular weight of 508.7 g/mol. IUPAC name: 3-(8,13-diethyl-3,7,12,17,20-pentamethyl-22,23-dihydroporphyrin-2-yl)propanoic acid. InChIKey: CZDYTYJSBCQSRP-UHFFFAOYSA-N.

Identity
Molecular formulaC32H36N4O2
Molecular weight508.7 g/mol
IUPAC name3-(8,13-diethyl-3,7,12,17,20-pentamethyl-22,23-dihydroporphyrin-2-yl)propanoic acid
InChIKeyCZDYTYJSBCQSRP-UHFFFAOYSA-N
SMILESCCC1=C(C2=CC3=C(C(=C(N3)C=C4C(=C(C(=N4)C(=C5C=C(C(=N5)C=C1N2)C)C)CCC(=O)O)C)C)CC)C

Computed by PubChem (NCBI)