CAS 1394040-54-0 appears in our catalog under these names: Sodium 2-((diethylamino)methyl)benzene-1-sulfonate, 95%, Sodium 2-((diethylamino)methyl)benzene-1-sulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Sodium 2-(diethylaminomethyl)benzenesulfonate (CAS 1394040-54-0) is a chemical compound with the molecular formula C11H16NNaO3S and a molecular weight of 265.31 g/mol. IUPAC name: sodium 2-(diethylaminomethyl)benzenesulfonate. InChIKey: ZUQIRSNZBVAHFC-UHFFFAOYSA-M.
| Molecular formula | C11H16NNaO3S |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | sodium 2-(diethylaminomethyl)benzenesulfonate |
| InChIKey | ZUQIRSNZBVAHFC-UHFFFAOYSA-M |
| SMILES | CCN(CC)CC1=CC=CC=C1S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)