CAS 1394042-23-9 appears in our catalog under these names: Sodium 2-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetate, 95%, Sodium 2-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Sodium 2-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetate (CAS 1394042-23-9) is a chemical compound with the molecular formula C15H14NNaO2S and a molecular weight of 295.3 g/mol. IUPAC name: sodium 2-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetate. InChIKey: FCYVVNFYESGMQM-UHFFFAOYSA-M.
| Molecular formula | C15H14NNaO2S |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | sodium 2-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetate |
| InChIKey | FCYVVNFYESGMQM-UHFFFAOYSA-M |
| SMILES | C1CC2=C(CC1C3=CC=CC=C3)SC(=N2)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)