Products 139406-15-8
CAS 139406-15-8 is the registry number for (1R)-1-(2-Chlorophenyl)-2,2-dimethylpropane-1,3-diol, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
(1R)-1-(2-chlorophenyl)-2,2-dimethylpropane-1,3-diol (CAS 139406-15-8) is a chemical compound with the molecular formula C11H15ClO2 and a molecular weight of 214.69 g/mol. IUPAC name: (1R)-1-(2-chlorophenyl)-2,2-dimethylpropane-1,3-diol. InChIKey: QRVPERDYBIBNET-JTQLQIEISA-N.
| Molecular formula | C11H15ClO2 |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | (1R)-1-(2-chlorophenyl)-2,2-dimethylpropane-1,3-diol |
| InChIKey | QRVPERDYBIBNET-JTQLQIEISA-N |
| SMILES | CC(C)(CO)[C@H](C1=CC=CC=C1Cl)O |
Computed by PubChem (NCBI)