Products 1394083-83-0
CAS 1394083-83-0 is the registry number for 5-Chloro-4-fluoro-2-nitrobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-chloro-4-fluoro-2-nitrobenzenesulfonyl chloride (CAS 1394083-83-0) is a chemical compound with the molecular formula C6H2Cl2FNO4S and a molecular weight of 274.05 g/mol. IUPAC name: 5-chloro-4-fluoro-2-nitrobenzenesulfonyl chloride. InChIKey: CAYHXIQWBSUACG-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO4S |
|---|---|
| Molecular weight | 274.05 g/mol |
| IUPAC name | 5-chloro-4-fluoro-2-nitrobenzenesulfonyl chloride |
| InChIKey | CAYHXIQWBSUACG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)