CAS 1394117-05-5 is the registry number for (3S)-5,5-Difluoro-2-azabicyclo[2.2.1]heptane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-5,5-difluoro-2-azabicyclo[2.2.1]heptane-3-carboxylic acid (CAS 1394117-05-5) is a chemical compound with the molecular formula C7H9F2NO2 and a molecular weight of 177.15 g/mol. IUPAC name: (3S)-5,5-difluoro-2-azabicyclo[2.2.1]heptane-3-carboxylic acid. InChIKey: LMCCQEIWUPDSEY-YCXLAJEKSA-N.
| Molecular formula | C7H9F2NO2 |
|---|---|
| Molecular weight | 177.15 g/mol |
| IUPAC name | (3S)-5,5-difluoro-2-azabicyclo[2.2.1]heptane-3-carboxylic acid |
| InChIKey | LMCCQEIWUPDSEY-YCXLAJEKSA-N |
| SMILES | C1C2CC(C1[C@H](N2)C(=O)O)(F)F |
Computed by PubChem (NCBI)